C16H20O6 — CID 139183138
(4aS,10S,10aR)-4a,10,10a-trihydroxy-5,8-dimethoxy-2,3,4,10-tetrahydro-1H-phenanthren-9-one (PubChem CID 139183138) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (4aS,10S,10aR)-4a,10,10a-trihydroxy-5,8-dimethoxy-2,3,4,10-tetrahydro-1H-phenanthren-9-one.
| Compound Name | (4aS,10S,10aR)-4a,10,10a-trihydroxy-5,8-dimethoxy-2,3,4,10-tetrahydro-1H-phenanthren-9-one |
|---|---|
| PubChem CID | 139183138 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (4aS,10S,10aR)-4a,10,10a-trihydroxy-5,8-dimethoxy-2,3,4,10-tetrahydro-1H-phenanthren-9-one |
| SMILES | COc1ccc(OC)c2c1C(=O)[C@@H](O)[C@]1(O)CCCC[C@]21O |
| InChI | InChI=1S/C16H20O6/c1-21-9-5-6-10(22-2)12-11(9)13(17)14(18)16(20)8-4-3-7-15(12,16)19/h5-6,14,18-20H,3-4,7-8H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | RPAPIOLPIRINRW-OWCLPIDISA-N |
| XLogP | 0.75 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |