C15H21F6N3O6S2 — CID 139183261
1-(2,2-dimethylpropyl)-3,4-dimethylimidazo[4,5-b]pyridine-3,4-diium;bis(trifluoromethanesulfonate) (PubChem CID 139183261) has the molecular formula C15H21F6N3O6S2 and a molecular weight of 517.47 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3,4-dimethylimidazo[4,5-b]pyridine-3,4-diium;bis(trifluoromethanesulfonate).
| Compound Name | 1-(2,2-dimethylpropyl)-3,4-dimethylimidazo[4,5-b]pyridine-3,4-diium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139183261 |
| Molecular Formula | C15H21F6N3O6S2 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3,4-dimethylimidazo[4,5-b]pyridine-3,4-diium;bis(trifluoromethanesulfonate) |
| SMILES | C[n+]1cccc2c1[n+](C)cn2CC(C)(C)C.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H21N3.2CHF3O3S/c1-13(2,3)9-16-10-15(5)12-11(16)7-6-8-14(12)4;2*2-1(3,4)8(5,6)7/h6-8,10H,9H2,1-5H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | FDVYWTHDFHFTQH-UHFFFAOYSA-L |
| XLogP | 1.44 |
| TPSA | 127.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|