C24H40O12 — CID 139183359
(1R,3S,4R,6S)-4,6-bis(prop-2-enoxy)cyclohexane-1,2,3,5-tetrol (PubChem CID 139183359) has the molecular formula C24H40O12 and a molecular weight of 520.57 g/mol. Its IUPAC name is (1R,3S,4R,6S)-4,6-bis(prop-2-enoxy)cyclohexane-1,2,3,5-tetrol.
| Compound Name | (1R,3S,4R,6S)-4,6-bis(prop-2-enoxy)cyclohexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 139183359 |
| Molecular Formula | C24H40O12 |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (1R,3S,4R,6S)-4,6-bis(prop-2-enoxy)cyclohexane-1,2,3,5-tetrol |
| SMILES | C=CCO[C@@H]1C(O)[C@H](OCC=C)[C@@H](O)C(O)[C@H]1O.C=CCO[C@@H]1C(O)[C@H](OCC=C)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/2C12H20O6/c2*1-3-5-17-11-8(14)7(13)9(15)12(10(11)16)18-6-4-2/h2*3-4,7-16H,1-2,5-6H2/t2*7?,8-,9+,10?,11+,12- |
| InChIKey | FIVZNVRUQJVYOQ-PGVFZCRUSA-N |
| XLogP | -2.83 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|