About methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate
methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate (PubChem CID 139183570) has the molecular formula C21H21FN2O3
and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate.
Molecular Properties
| Compound Name | methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate |
| PubChem CID | 139183570 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate |
| SMILES | COC(=O)/C(C[C@H](c1ccccc1F)c1c(C)c2ccccc2n1C)=N/O |
| InChI | InChI=1S/C21H21FN2O3/c1-13-14-8-5-7-11-19(14)24(2)20(13)16(12-18(23-26)21(25)27-3)15-9-4-6-10-17(15)22/h4-11,16,26H,12H2,1-3H3/b23-18+/t16-/m1/s1 |
| InChIKey | IBHCLHLQVMZJAP-PJWCADQQSA-N |
| XLogP | 4.15 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate?
The IUPAC name of methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate (CID 139183570) is methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate.
What is the SMILES notation for methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate?
The canonical SMILES for methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate is COC(=O)/C(C[C@H](c1ccccc1F)c1c(C)c2ccccc2n1C)=N/O.
What is the InChIKey of methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate?
The InChIKey is IBHCLHLQVMZJAP-PJWCADQQSA-N. The full InChI is InChI=1S/C21H21FN2O3/c1-13-14-8-5-7-11-19(14)24(2)20(13)16(12-18(23-26)21(25)27-3)15-9-4-6-10-17(15)22/h4-11,16,26H,12H2,1-3H3/b23-18+/t16-/m1/s1.
What are the key properties of methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate?
methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate has a molecular weight of 368.41 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E,4R)-4-(1,3-dimethylindol-2-yl)-4-(2-fluorophenyl)-2-hydroxyiminobutanoate is sourced from PubChem (CID 139183570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).