C24H28ClN2O2+ — CID 139183610
2-chloro-5,5-dimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione (PubChem CID 139183610) has the molecular formula C24H28ClN2O2+ and a molecular weight of 411.95 g/mol. Its IUPAC name is 2-chloro-5,5-dimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione.
| Compound Name | 2-chloro-5,5-dimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione |
|---|---|
| PubChem CID | 139183610 |
| Molecular Formula | C24H28ClN2O2+ |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-chloro-5,5-dimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione |
| SMILES | Cc1cc(C)c(N2C(=O)C(C)(C)C(=O)[N+](c3c(C)cc(C)cc3C)=C2Cl)c(C)c1 |
| InChI | InChI=1S/C24H28ClN2O2/c1-13-9-15(3)19(16(4)10-13)26-21(28)24(7,8)22(29)27(23(26)25)20-17(5)11-14(2)12-18(20)6/h9-12H,1-8H3/q+1 |
| InChIKey | LECSBFGVOGTXGI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|