C29H32N2O4S — CID 139183631
(E)-N,N-dibenzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N'-(4-methylphenyl)sulfonylprop-2-enimidamide (PubChem CID 139183631) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N'-(4-methylphenyl)sulfonylprop-2-enimidamide.
| Compound Name | (E)-N,N-dibenzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N'-(4-methylphenyl)sulfonylprop-2-enimidamide |
|---|---|
| PubChem CID | 139183631 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (E)-N,N-dibenzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N'-(4-methylphenyl)sulfonylprop-2-enimidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\C=C\[C@@H]2COC(C)(C)O2)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O4S/c1-23-14-17-27(18-15-23)36(32,33)30-28(19-16-26-22-34-29(2,3)35-26)31(20-24-10-6-4-7-11-24)21-25-12-8-5-9-13-25/h4-19,26H,20-22H2,1-3H3/b19-16+,30-28+/t26-/m1/s1 |
| InChIKey | VYEYVJUOIZRLGB-ITTKHJGXSA-N |
| XLogP | 5.49 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|