C15H5F9O — CID 139183763
(2S,5S,7R)-2,4,5,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)tricyclo[3.3.1.02,7]non-3-en-6-one (PubChem CID 139183763) has the molecular formula C15H5F9O and a molecular weight of 372.19 g/mol. Its IUPAC name is (2S,5S,7R)-2,4,5,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)tricyclo[3.3.1.02,7]non-3-en-6-one.
| Compound Name | (2S,5S,7R)-2,4,5,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)tricyclo[3.3.1.02,7]non-3-en-6-one |
|---|---|
| PubChem CID | 139183763 |
| Molecular Formula | C15H5F9O |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | (2S,5S,7R)-2,4,5,7-tetrafluoro-3-(2,3,4,5,6-pentafluorophenyl)tricyclo[3.3.1.02,7]non-3-en-6-one |
| SMILES | O=C1[C@@]2(F)C[C@H]3C[C@]1(F)[C@@]3(F)C(c1c(F)c(F)c(F)c(F)c1F)=C2F |
| InChI | InChI=1S/C15H5F9O/c16-6-4(7(17)9(19)10(20)8(6)18)5-11(21)13(22)1-3-2-14(23,12(13)25)15(3,5)24/h3H,1-2H2/t3-,13+,14+,15-/m0/s1 |
| InChIKey | FXKAEKXMHPRKIC-IVAXCTQTSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|