C21H24N2O — CID 139184096
1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-3-ium-2-id-5-one (PubChem CID 139184096) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-3-ium-2-id-5-one.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-3-ium-2-id-5-one |
|---|---|
| PubChem CID | 139184096 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2,4-dihydroimidazol-3-ium-2-id-5-one |
| SMILES | Cc1cc(C)c(N2[C-]=[N+](c3c(C)cc(C)cc3C)CC2=O)c(C)c1 |
| InChI | InChI=1S/C21H24N2O/c1-13-7-15(3)20(16(4)8-13)22-11-19(24)23(12-22)21-17(5)9-14(2)10-18(21)6/h7-10H,11H2,1-6H3 |
| InChIKey | DJILRJBTWONTLT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|