C30H8BF15N2 — CID 139184173
tris(2,3,4,5,6-pentafluorophenyl)-(1,10-phenanthrolin-1-ium-1-yl)boranuide (PubChem CID 139184173) has the molecular formula C30H8BF15N2 and a molecular weight of 692.19 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-(1,10-phenanthrolin-1-ium-1-yl)boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-(1,10-phenanthrolin-1-ium-1-yl)boranuide |
|---|---|
| PubChem CID | 139184173 |
| Molecular Formula | C30H8BF15N2 |
| Molecular Weight | 692.19 g/mol |
| Exact Mass | 692.05 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-(1,10-phenanthrolin-1-ium-1-yl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[n+]2cccc3ccc4cccnc4c32)c(F)c1F |
| InChI | InChI=1S/C30H8BF15N2/c32-14-11(15(33)21(39)26(44)20(14)38)31(12-16(34)22(40)27(45)23(41)17(12)35,13-18(36)24(42)28(46)25(43)19(13)37)48-8-2-4-10-6-5-9-3-1-7-47-29(9)30(10)48/h1-8H |
| InChIKey | DZKQFHIAOIRRDH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.19 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|