C19H20F3NO6 — CID 139185175
methyl (6S,8S)-5-oxo-6-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (PubChem CID 139185175) has the molecular formula C19H20F3NO6 and a molecular weight of 415.36 g/mol. Its IUPAC name is methyl (6S,8S)-5-oxo-6-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
| Compound Name | methyl (6S,8S)-5-oxo-6-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 139185175 |
| Molecular Formula | C19H20F3NO6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl (6S,8S)-5-oxo-6-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| SMILES | COC(=O)[C@@]12CCCN1C(=O)[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)C2 |
| InChI | InChI=1S/C19H20F3NO6/c1-27-15(25)17-9-6-10-23(17)14(24)13(11-17)29-16(26)18(28-2,19(20,21)22)12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3/t13-,17-,18+/m0/s1 |
| InChIKey | NQIUKKYLKYOFMH-DOPJRALCSA-N |
| XLogP | 1.94 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |