C32H32Cl2N2O2S2 — CID 139185303
dichloromethane;5,13-dimethyl-3,11-bis[(S)-(4-methylphenyl)sulfinyl]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 139185303) has the molecular formula C32H32Cl2N2O2S2 and a molecular weight of 611.66 g/mol. Its IUPAC name is dichloromethane;5,13-dimethyl-3,11-bis[(S)-(4-methylphenyl)sulfinyl]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | dichloromethane;5,13-dimethyl-3,11-bis[(S)-(4-methylphenyl)sulfinyl]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 139185303 |
| Molecular Formula | C32H32Cl2N2O2S2 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | dichloromethane;5,13-dimethyl-3,11-bis[(S)-(4-methylphenyl)sulfinyl]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | Cc1ccc([S@](=O)c2cc(C)cc3c2N2Cc4cc(C)cc([S@@](=O)c5ccc(C)cc5)c4N(C3)C2)cc1.ClCCl |
| InChI | InChI=1S/C31H30N2O2S2.CH2Cl2/c1-20-5-9-26(10-6-20)36(34)28-15-22(3)13-24-17-33-19-32(30(24)28)18-25-14-23(4)16-29(31(25)33)37(35)27-11-7-21(2)8-12-27;2-1-3/h5-16H,17-19H2,1-4H3;1H2/t36-,37-;/m0./s1 |
| InChIKey | YPDWDXUTBACMHS-GVGVJZOBSA-N |
| XLogP | 7.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|