C18H20O4 — CID 139185308
(1S,4R,6R,7S,8S,13R)-6-(4-methylphenoxy)-5,12-dioxatetracyclo[5.4.2.01,8.04,13]tridecan-2-one (PubChem CID 139185308) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (1S,4R,6R,7S,8S,13R)-6-(4-methylphenoxy)-5,12-dioxatetracyclo[5.4.2.01,8.04,13]tridecan-2-one.
| Compound Name | (1S,4R,6R,7S,8S,13R)-6-(4-methylphenoxy)-5,12-dioxatetracyclo[5.4.2.01,8.04,13]tridecan-2-one |
|---|---|
| PubChem CID | 139185308 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (1S,4R,6R,7S,8S,13R)-6-(4-methylphenoxy)-5,12-dioxatetracyclo[5.4.2.01,8.04,13]tridecan-2-one |
| SMILES | Cc1ccc(O[C@H]2O[C@@H]3CC(=O)[C@]45CCC[C@H]4[C@H]2[C@H]3O5)cc1 |
| InChI | InChI=1S/C18H20O4/c1-10-4-6-11(7-5-10)20-17-15-12-3-2-8-18(12)14(19)9-13(21-17)16(15)22-18/h4-7,12-13,15-17H,2-3,8-9H2,1H3/t12-,13+,15-,16-,17-,18-/m0/s1 |
| InChIKey | WEJAYUMIQZENOF-PYCKYVDESA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |