C19H24BNO2 — CID 139185347
11'-ethyl-4,4,5,5-tetramethylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7-azonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene] (PubChem CID 139185347) has the molecular formula C19H24BNO2 and a molecular weight of 309.22 g/mol. Its IUPAC name is 11'-ethyl-4,4,5,5-tetramethylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7-azonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene].
| Compound Name | 11'-ethyl-4,4,5,5-tetramethylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7-azonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene] |
|---|---|
| PubChem CID | 139185347 |
| Molecular Formula | C19H24BNO2 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 11'-ethyl-4,4,5,5-tetramethylspiro[1,3-dioxa-2-boranuidacyclopentane-2,8'-7-azonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene] |
| SMILES | CCc1ccc2c(c1)[B-]1(OC(C)(C)C(C)(C)O1)[n+]1ccccc1-2 |
| InChI | InChI=1S/C19H24BNO2/c1-6-14-10-11-15-16(13-14)20(21-12-8-7-9-17(15)21)22-18(2,3)19(4,5)23-20/h7-13H,6H2,1-5H3 |
| InChIKey | DSPQWXOTVWMVPB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|