C27H33BO6S2 — CID 139185377
2-[(1E)-1-[(2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentylidene]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139185377) has the molecular formula C27H33BO6S2 and a molecular weight of 528.50 g/mol. Its IUPAC name is 2-[(1E)-1-[(2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentylidene]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E)-1-[(2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentylidene]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139185377 |
| Molecular Formula | C27H33BO6S2 |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-[(1E)-1-[(2S)-4,4-bis(benzenesulfonyl)-2-ethenylcyclopentylidene]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C[C@@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C/C1=C(\C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H33BO6S2/c1-7-21-18-27(35(29,30)22-14-10-8-11-15-22,36(31,32)23-16-12-9-13-17-23)19-24(21)20(2)28-33-25(3,4)26(5,6)34-28/h7-17,21H,1,18-19H2,2-6H3/b24-20-/t21-/m1/s1 |
| InChIKey | XETOTCAEBSSDBV-SSXUBFHHSA-N |
| XLogP | 5.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|