C10H15NO5 — CID 139185449
(4S)-4-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,3-oxazolidin-2-one (PubChem CID 139185449) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (4S)-4-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139185449 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (4S)-4-[(3aS,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@@H]3COC(=O)N3)OC[C@H]2O1 |
| InChI | InChI=1S/C10H15NO5/c1-10(2)15-6-4-13-7(8(6)16-10)5-3-14-9(12)11-5/h5-8H,3-4H2,1-2H3,(H,11,12)/t5-,6+,7+,8+/m0/s1 |
| InChIKey | GGPCHDSVOLORFT-LXGUWJNJSA-N |
| XLogP | 0.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |