C61H48N20 — CID 139185534
6-[4-[4-[tris[4-[4-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]phenyl]methyl]phenyl]phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 139185534) has the molecular formula C61H48N20 and a molecular weight of 1061.19 g/mol. Its IUPAC name is 6-[4-[4-[tris[4-[4-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]phenyl]methyl]phenyl]phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-[4-[tris[4-[4-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]phenyl]methyl]phenyl]phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139185534 |
| Molecular Formula | C61H48N20 |
| Molecular Weight | 1061.19 g/mol |
| Exact Mass | 1060.44 |
| IUPAC Name | 6-[4-[4-[tris[4-[4-(4,6-diamino-1,3,5-triazin-2-yl)phenyl]phenyl]methyl]phenyl]phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccc(-c3ccc(C(c4ccc(-c5ccc(-c6nc(N)nc(N)n6)cc5)cc4)(c4ccc(-c5ccc(-c6nc(N)nc(N)n6)cc5)cc4)c4ccc(-c5ccc(-c6nc(N)nc(N)n6)cc5)cc4)cc3)cc2)n1 |
| InChI | InChI=1S/C61H48N20/c62-53-70-49(71-54(63)78-53)41-9-1-33(2-10-41)37-17-25-45(26-18-37)61(46-27-19-38(20-28-46)34-3-11-42(12-4-34)50-72-55(64)79-56(65)73-50,47-29-21-39(22-30-47)35-5-13-43(14-6-35)51-74-57(66)80-58(67)75-51)48-31-23-40(24-32-48)36-7-15-44(16-8-36)52-76-59(68)81-60(69)77-52/h1-32H,(H4,62,63,70,71,78)(H4,64,65,72,73,79)(H4,66,67,74,75,80)(H4,68,69,76,77,81) |
| InChIKey | GJSZUSMTAPWWDX-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 362.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 81 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.19 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|