C29H26N2O6S — CID 139185552
ethyl (5S)-1-(4-methylphenyl)sulfonyl-6,8-dioxo-2,7-diphenyl-1,7-diazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 139185552) has the molecular formula C29H26N2O6S and a molecular weight of 530.60 g/mol. Its IUPAC name is ethyl (5S)-1-(4-methylphenyl)sulfonyl-6,8-dioxo-2,7-diphenyl-1,7-diazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | ethyl (5S)-1-(4-methylphenyl)sulfonyl-6,8-dioxo-2,7-diphenyl-1,7-diazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 139185552 |
| Molecular Formula | C29H26N2O6S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | ethyl (5S)-1-(4-methylphenyl)sulfonyl-6,8-dioxo-2,7-diphenyl-1,7-diazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)[C@]2(CC(=O)N(c3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C29H26N2O6S/c1-3-37-27(33)24-18-29(19-25(32)30(28(29)34)22-12-8-5-9-13-22)31(26(24)21-10-6-4-7-11-21)38(35,36)23-16-14-20(2)15-17-23/h4-17H,3,18-19H2,1-2H3/t29-/m0/s1 |
| InChIKey | DNHJCIXKJJNMPN-LJAQVGFWSA-N |
| XLogP | 4.07 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|