C19H17BrO2 — CID 139185571
(2S,3R)-1-(4-bromophenyl)-3-(4-methoxyphenyl)-2-methylpent-4-yn-1-one (PubChem CID 139185571) has the molecular formula C19H17BrO2 and a molecular weight of 357.25 g/mol. Its IUPAC name is (2S,3R)-1-(4-bromophenyl)-3-(4-methoxyphenyl)-2-methylpent-4-yn-1-one.
| Compound Name | (2S,3R)-1-(4-bromophenyl)-3-(4-methoxyphenyl)-2-methylpent-4-yn-1-one |
|---|---|
| PubChem CID | 139185571 |
| Molecular Formula | C19H17BrO2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (2S,3R)-1-(4-bromophenyl)-3-(4-methoxyphenyl)-2-methylpent-4-yn-1-one |
| SMILES | C#C[C@H](c1ccc(OC)cc1)[C@H](C)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrO2/c1-4-18(14-7-11-17(22-3)12-8-14)13(2)19(21)15-5-9-16(20)10-6-15/h1,5-13,18H,2-3H3/t13-,18-/m0/s1 |
| InChIKey | IUBQDPPGVOHNTO-UGSOOPFHSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|