C20H22O8 — CID 139185587
dimethyl (1R,2S,5S)-5-ethyl-2-(4-methoxycarbonylphenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate (PubChem CID 139185587) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is dimethyl (1R,2S,5S)-5-ethyl-2-(4-methoxycarbonylphenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate.
| Compound Name | dimethyl (1R,2S,5S)-5-ethyl-2-(4-methoxycarbonylphenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 139185587 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | dimethyl (1R,2S,5S)-5-ethyl-2-(4-methoxycarbonylphenyl)-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
| SMILES | CC[C@]12CC(C(=O)OC)(C(=O)OC)[C@H](c3ccc(C(=O)OC)cc3)[C@H]1C(=O)O2 |
| InChI | InChI=1S/C20H22O8/c1-5-19-10-20(17(23)26-3,18(24)27-4)13(14(19)16(22)28-19)11-6-8-12(9-7-11)15(21)25-2/h6-9,13-14H,5,10H2,1-4H3/t13-,14+,19+/m1/s1 |
| InChIKey | AUGLPQHGFFRFHQ-TYILLQQXSA-N |
| XLogP | 1.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|