About bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine
bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine (PubChem CID 139185657) has the molecular formula C24H22N2O4
and a molecular weight of 402.45 g/mol. Its IUPAC name is bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine.
Molecular Properties
| Compound Name | bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine |
| PubChem CID | 139185657 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine |
| SMILES | C(=C/c1ccccn1)\c1ccccn1.Oc1ccccc1O.Oc1ccccc1O |
| InChI | InChI=1S/C12H10N2.2C6H6O2/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12;2*7-5-3-1-2-4-6(5)8/h1-10H;2*1-4,7-8H/b8-7+;; |
| InChIKey | HKSLHAQIDCTEJC-MIIBGCIDSA-N |
| XLogP | 4.84 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine?
The IUPAC name of bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine (CID 139185657) is bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine.
What is the SMILES notation for bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine?
The canonical SMILES for bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine is C(=C/c1ccccn1)\c1ccccn1.Oc1ccccc1O.Oc1ccccc1O.
What is the InChIKey of bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine?
The InChIKey is HKSLHAQIDCTEJC-MIIBGCIDSA-N. The full InChI is InChI=1S/C12H10N2.2C6H6O2/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12;2*7-5-3-1-2-4-6(5)8/h1-10H;2*1-4,7-8H/b8-7+;;.
What are the key properties of bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine?
bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine has a molecular weight of 402.45 g/mol, XLogP of 4.84, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,2-diol);2-[(E)-2-pyridin-2-ylethenyl]pyridine is sourced from PubChem (CID 139185657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).