C24H31N — CID 139186100
(1S,3S,8aR)-3-butyl-1-(4-phenylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 139186100) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is (1S,3S,8aR)-3-butyl-1-(4-phenylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (1S,3S,8aR)-3-butyl-1-(4-phenylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 139186100 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (1S,3S,8aR)-3-butyl-1-(4-phenylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCCC[C@H]1C[C@@H](c2ccc(-c3ccccc3)cc2)[C@H]2CCCCN12 |
| InChI | InChI=1S/C24H31N/c1-2-3-11-22-18-23(24-12-7-8-17-25(22)24)21-15-13-20(14-16-21)19-9-5-4-6-10-19/h4-6,9-10,13-16,22-24H,2-3,7-8,11-12,17-18H2,1H3/t22-,23-,24+/m0/s1 |
| InChIKey | FIXRXMREXUSIAX-KMDXXIMOSA-N |
| XLogP | 6.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |