C40H38N2O8 — CID 139186514
[2-[13-[2-acetyloxy-5-(2-methylbutan-2-yl)phenyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-(2-methylbutan-2-yl)phenyl] acetate (PubChem CID 139186514) has the molecular formula C40H38N2O8 and a molecular weight of 674.75 g/mol. Its IUPAC name is [2-[13-[2-acetyloxy-5-(2-methylbutan-2-yl)phenyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-(2-methylbutan-2-yl)phenyl] acetate.
| Compound Name | [2-[13-[2-acetyloxy-5-(2-methylbutan-2-yl)phenyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-(2-methylbutan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 139186514 |
| Molecular Formula | C40H38N2O8 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | [2-[13-[2-acetyloxy-5-(2-methylbutan-2-yl)phenyl]-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-(2-methylbutan-2-yl)phenyl] acetate |
| SMILES | CCC(C)(C)c1ccc(OC(C)=O)c(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2cc(C(C)(C)CC)ccc2OC(C)=O)C4=O)c1 |
| InChI | InChI=1S/C40H38N2O8/c1-9-39(5,6)23-11-17-31(49-21(3)43)29(19-23)41-35(45)25-13-15-27-34-28(16-14-26(33(25)34)36(41)46)38(48)42(37(27)47)30-20-24(40(7,8)10-2)12-18-32(30)50-22(4)44/h11-20H,9-10H2,1-8H3 |
| InChIKey | YNWGUNQTNWEVIO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|