C28H52N4Si2 — CID 139186517
3,6-diimino-2-[2-tri(propan-2-yl)silylethyl]-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine (PubChem CID 139186517) has the molecular formula C28H52N4Si2 and a molecular weight of 500.92 g/mol. Its IUPAC name is 3,6-diimino-2-[2-tri(propan-2-yl)silylethyl]-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine.
| Compound Name | 3,6-diimino-2-[2-tri(propan-2-yl)silylethyl]-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 139186517 |
| Molecular Formula | C28H52N4Si2 |
| Molecular Weight | 500.92 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 3,6-diimino-2-[2-tri(propan-2-yl)silylethyl]-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine |
| SMILES | [H]/N=C1\C(N)=C(C#C[Si](C(C)C)(C(C)C)C(C)C)/C(=N\[H])C(N)=C1CC[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H52N4Si2/c1-17(2)33(18(3)4,19(5)6)15-13-23-25(29)27(31)24(28(32)26(23)30)14-16-34(20(7)8,21(9)10)22(11)12/h17-22,29,32H,13,15,30-31H2,1-12H3/b29-25-,32-28+ |
| InChIKey | CKHXKTDPTSNNQE-UFEFDASSSA-N |
| XLogP | 7.76 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.92 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|