C18H19NO3 — CID 139186710
methyl (2R,3S,4R)-3-hydroxy-2,4-diphenylpyrrolidine-3-carboxylate (PubChem CID 139186710) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl (2R,3S,4R)-3-hydroxy-2,4-diphenylpyrrolidine-3-carboxylate.
| Compound Name | methyl (2R,3S,4R)-3-hydroxy-2,4-diphenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139186710 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl (2R,3S,4R)-3-hydroxy-2,4-diphenylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@]1(O)[C@@H](c2ccccc2)NC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-22-17(20)18(21)15(13-8-4-2-5-9-13)12-19-16(18)14-10-6-3-7-11-14/h2-11,15-16,19,21H,12H2,1H3/t15-,16+,18-/m0/s1 |
| InChIKey | OVPFSLBJCZOTPA-JZXOWHBKSA-N |
| XLogP | 2.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |