About (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one
(2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one (PubChem CID 139187282) has the molecular formula C16H12FNO2
and a molecular weight of 269.28 g/mol. Its IUPAC name is (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one |
| PubChem CID | 139187282 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one |
| SMILES | O=C1O[C@](CF)(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C16H12FNO2/c17-11-16(13-9-5-2-6-10-13)18-14(15(19)20-16)12-7-3-1-4-8-12/h1-10H,11H2/t16-/m1/s1 |
| InChIKey | YBYZJNGMPMZKNB-MRXNPFEDSA-N |
| XLogP | 2.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one?
The IUPAC name of (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one (CID 139187282) is (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one.
What is the SMILES notation for (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one?
The canonical SMILES for (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one is O=C1O[C@](CF)(c2ccccc2)N=C1c1ccccc1.
What is the InChIKey of (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one?
The InChIKey is YBYZJNGMPMZKNB-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H12FNO2/c17-11-16(13-9-5-2-6-10-13)18-14(15(19)20-16)12-7-3-1-4-8-12/h1-10H,11H2/t16-/m1/s1.
What are the key properties of (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one?
(2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one has a molecular weight of 269.28 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(fluoromethyl)-2,4-diphenyl-1,3-oxazol-5-one is sourced from PubChem (CID 139187282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).