C19H16BF7N4 — CID 139187284
[2,2-difluoro-12-methylimino-8-(2,3,4,5,6-pentafluorophenyl)-1,3-diaza-2-boranuidatricyclo[7.3.0.03,7]dodeca-4,6,8,10-tetraen-4-yl]-trimethylazanium (PubChem CID 139187284) has the molecular formula C19H16BF7N4 and a molecular weight of 444.16 g/mol. Its IUPAC name is [2,2-difluoro-12-methylimino-8-(2,3,4,5,6-pentafluorophenyl)-1,3-diaza-2-boranuidatricyclo[7.3.0.03,7]dodeca-4,6,8,10-tetraen-4-yl]-trimethylazanium.
| Compound Name | [2,2-difluoro-12-methylimino-8-(2,3,4,5,6-pentafluorophenyl)-1,3-diaza-2-boranuidatricyclo[7.3.0.03,7]dodeca-4,6,8,10-tetraen-4-yl]-trimethylazanium |
|---|---|
| PubChem CID | 139187284 |
| Molecular Formula | C19H16BF7N4 |
| Molecular Weight | 444.16 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [2,2-difluoro-12-methylimino-8-(2,3,4,5,6-pentafluorophenyl)-1,3-diaza-2-boranuidatricyclo[7.3.0.03,7]dodeca-4,6,8,10-tetraen-4-yl]-trimethylazanium |
| SMILES | C/N=C1\C=CC2=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc([N+](C)(C)C)n3[B-](F)(F)N21 |
| InChI | InChI=1S/C19H16BF7N4/c1-28-11-7-5-9-13(14-15(21)17(23)19(25)18(24)16(14)22)10-6-8-12(31(2,3)4)30(10)20(26,27)29(9)11/h5-8H,1-4H3/b28-11+ |
| InChIKey | BFFQZKSJKRWKGM-IPBVOBEMSA-N |
| XLogP | 4.28 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|