About (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole
(4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole (PubChem CID 139187377) has the molecular formula C16H13F3N2O
and a molecular weight of 306.29 g/mol. Its IUPAC name is (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole.
Molecular Properties
| Compound Name | (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole |
| PubChem CID | 139187377 |
| Molecular Formula | C16H13F3N2O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole |
| SMILES | Cc1ccc([C@]2(C(F)(F)F)N=CO[C@H]2c2ccccn2)cc1 |
| InChI | InChI=1S/C16H13F3N2O/c1-11-5-7-12(8-6-11)15(16(17,18)19)14(22-10-21-15)13-4-2-3-9-20-13/h2-10,14H,1H3/t14-,15-/m0/s1 |
| InChIKey | WARUTNRKEULVQC-GJZGRUSLSA-N |
| XLogP | 3.95 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole?
The IUPAC name of (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole (CID 139187377) is (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole.
What is the SMILES notation for (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole?
The canonical SMILES for (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole is Cc1ccc([C@]2(C(F)(F)F)N=CO[C@H]2c2ccccn2)cc1.
What is the InChIKey of (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole?
The InChIKey is WARUTNRKEULVQC-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H13F3N2O/c1-11-5-7-12(8-6-11)15(16(17,18)19)14(22-10-21-15)13-4-2-3-9-20-13/h2-10,14H,1H3/t14-,15-/m0/s1.
What are the key properties of (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole?
(4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole has a molecular weight of 306.29 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-(4-methylphenyl)-5-pyridin-2-yl-4-(trifluoromethyl)-5H-1,3-oxazole is sourced from PubChem (CID 139187377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).