C35H17BF10OTe — CID 139187740
3,5-bis(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-4-phenylmethoxy-1,4-telluraborinine (PubChem CID 139187740) has the molecular formula C35H17BF10OTe and a molecular weight of 781.91 g/mol. Its IUPAC name is 3,5-bis(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-4-phenylmethoxy-1,4-telluraborinine.
| Compound Name | 3,5-bis(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-4-phenylmethoxy-1,4-telluraborinine |
|---|---|
| PubChem CID | 139187740 |
| Molecular Formula | C35H17BF10OTe |
| Molecular Weight | 781.91 g/mol |
| Exact Mass | 784.03 |
| IUPAC Name | 3,5-bis(2,3,4,5,6-pentafluorophenyl)-2,6-diphenyl-4-phenylmethoxy-1,4-telluraborinine |
| SMILES | Fc1c(F)c(F)c(C2=C(c3ccccc3)[Te]C(c3ccccc3)=C(c3c(F)c(F)c(F)c(F)c3F)B2OCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C35H17BF10OTe/c37-24-20(25(38)29(42)32(45)28(24)41)22-34(18-12-6-2-7-13-18)48-35(19-14-8-3-9-15-19)23(36(22)47-16-17-10-4-1-5-11-17)21-26(39)30(43)33(46)31(44)27(21)40/h1-15H,16H2 |
| InChIKey | PXSRRVIPGWRMKF-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.91 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|