About (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole
(2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole (PubChem CID 139187750) has the molecular formula C29H23F2NO2S
and a molecular weight of 487.57 g/mol. Its IUPAC name is (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole |
| PubChem CID | 139187750 |
| Molecular Formula | C29H23F2NO2S |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2C(c3ccc(F)cc3)=C(c3ccc(F)cc3)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23F2NO2S/c1-20-7-17-26(18-8-20)35(33,34)32-28(22-5-3-2-4-6-22)19-27(21-9-13-24(30)14-10-21)29(32)23-11-15-25(31)16-12-23/h2-18,28H,19H2,1H3/t28-/m1/s1 |
| InChIKey | YPQPBYUGSJRAKF-MUUNZHRXSA-N |
| XLogP | 6.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole?
The IUPAC name of (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole (CID 139187750) is (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole.
What is the SMILES notation for (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole?
The canonical SMILES for (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole is Cc1ccc(S(=O)(=O)N2C(c3ccc(F)cc3)=C(c3ccc(F)cc3)C[C@@H]2c2ccccc2)cc1.
What is the InChIKey of (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole?
The InChIKey is YPQPBYUGSJRAKF-MUUNZHRXSA-N. The full InChI is InChI=1S/C29H23F2NO2S/c1-20-7-17-26(18-8-20)35(33,34)32-28(22-5-3-2-4-6-22)19-27(21-9-13-24(30)14-10-21)29(32)23-11-15-25(31)16-12-23/h2-18,28H,19H2,1H3/t28-/m1/s1.
What are the key properties of (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole?
(2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole has a molecular weight of 487.57 g/mol, XLogP of 6.98, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,5-bis(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrrole is sourced from PubChem (CID 139187750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).