C22H19NO5 — CID 139188000
(3R)-5-hydroxy-2'-(2-hydroxyethyl)-4'-methoxy-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-3,3'-isoindole]-1'-one (PubChem CID 139188000) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is (3R)-5-hydroxy-2'-(2-hydroxyethyl)-4'-methoxy-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-3,3'-isoindole]-1'-one.
| Compound Name | (3R)-5-hydroxy-2'-(2-hydroxyethyl)-4'-methoxy-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-3,3'-isoindole]-1'-one |
|---|---|
| PubChem CID | 139188000 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (3R)-5-hydroxy-2'-(2-hydroxyethyl)-4'-methoxy-10-methylspiro[2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-3,3'-isoindole]-1'-one |
| SMILES | COc1cccc2c1[C@@]1(Oc3cc(C)cc4ccc(O)c1c34)N(CCO)C2=O |
| InChI | InChI=1S/C22H19NO5/c1-12-10-13-6-7-15(25)20-18(13)17(11-12)28-22(20)19-14(4-3-5-16(19)27-2)21(26)23(22)8-9-24/h3-7,10-11,24-25H,8-9H2,1-2H3/t22-/m0/s1 |
| InChIKey | TXNICMSEHSRCQN-QFIPXVFZSA-N |
| XLogP | 2.90 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|