C54H52B2N6O4 — CID 139188218
2,6-dipyridin-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 139188218) has the molecular formula C54H52B2N6O4 and a molecular weight of 870.67 g/mol. Its IUPAC name is 2,6-dipyridin-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2,6-dipyridin-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 139188218 |
| Molecular Formula | C54H52B2N6O4 |
| Molecular Weight | 870.67 g/mol |
| Exact Mass | 870.42 |
| IUPAC Name | 2,6-dipyridin-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)OC1(C)C.CC1(C)OB(c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)OC1(C)C |
| InChI | InChI=1S/2C27H26BN3O2/c2*1-26(2)27(3,4)33-28(32-26)21-13-11-19(12-14-21)20-17-24(22-9-5-7-15-29-22)31-25(18-20)23-10-6-8-16-30-23/h2*5-18H,1-4H3 |
| InChIKey | NFMBGEMDSWRMNE-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.67 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|