C30H30N6 — CID 139188356
2,3-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene (PubChem CID 139188356) has the molecular formula C30H30N6 and a molecular weight of 474.61 g/mol. Its IUPAC name is 2,3-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene.
| Compound Name | 2,3-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene |
|---|---|
| PubChem CID | 139188356 |
| Molecular Formula | C30H30N6 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2,3-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene |
| SMILES | c1cc2c3c([nH]nc3c1)CCC2.c1cc2c3c([nH]nc3c1)CCC2.c1cc2c3c([nH]nc3c1)CCC2 |
| InChI | InChI=1S/3C10H10N2/c3*1-3-7-4-2-6-9-10(7)8(5-1)11-12-9/h3*1,3,5H,2,4,6H2,(H,11,12) |
| InChIKey | IRJXXHLTAJCXPQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |