C148H204Si6 — CID 139188820
4,5-diphenyl-1,1,2,3-tetrakis[2,4,6-tri(propan-2-yl)phenyl]trisilole (PubChem CID 139188820) has the molecular formula C148H204Si6 and a molecular weight of 2151.78 g/mol. Its IUPAC name is 4,5-diphenyl-1,1,2,3-tetrakis[2,4,6-tri(propan-2-yl)phenyl]trisilole.
| Compound Name | 4,5-diphenyl-1,1,2,3-tetrakis[2,4,6-tri(propan-2-yl)phenyl]trisilole |
|---|---|
| PubChem CID | 139188820 |
| Molecular Formula | C148H204Si6 |
| Molecular Weight | 2151.78 g/mol |
| Exact Mass | 2149.46 |
| IUPAC Name | 4,5-diphenyl-1,1,2,3-tetrakis[2,4,6-tri(propan-2-yl)phenyl]trisilole |
| SMILES | CC(C)c1cc(C(C)C)c([Si]2=[Si](c3c(C(C)C)cc(C(C)C)cc3C(C)C)[Si](c3c(C(C)C)cc(C(C)C)cc3C(C)C)(c3c(C(C)C)cc(C(C)C)cc3C(C)C)C(c3ccccc3)=C2c2ccccc2)c(C(C)C)c1.CC(C)c1cc(C(C)C)c([Si]2=[Si](c3c(C(C)C)cc(C(C)C)cc3C(C)C)[Si](c3c(C(C)C)cc(C(C)C)cc3C(C)C)(c3c(C(C)C)cc(C(C)C)cc3C(C)C)C(c3ccccc3)=C2c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/2C74H102Si3/c2*1-43(2)57-35-61(47(9)10)70(62(36-57)48(11)12)75-69(55-31-27-25-28-32-55)72(56-33-29-26-30-34-56)77(73-65(51(17)18)39-59(45(5)6)40-66(73)52(19)20,74-67(53(21)22)41-60(46(7)8)42-68(74)54(23)24)76(75)71-63(49(13)14)37-58(44(3)4)38-64(71)50(15)16/h2*25-54H,1-24H3 |
| InChIKey | BHZZEHUCVOWZKN-UHFFFAOYSA-N |
| XLogP | 38.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 36 |
| Heavy Atoms | 154 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2151.78 |
| LogP ≤ 5 | 38.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|