C22H22F3NO3 — CID 139188975
(3R,4R)-1-benzyl-3-[(1R)-1-hydroxy-3-phenylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione (PubChem CID 139188975) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3-[(1R)-1-hydroxy-3-phenylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione.
| Compound Name | (3R,4R)-1-benzyl-3-[(1R)-1-hydroxy-3-phenylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 139188975 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (3R,4R)-1-benzyl-3-[(1R)-1-hydroxy-3-phenylpropyl]-4-(trifluoromethyl)piperidine-2,6-dione |
| SMILES | O=C1C[C@@H](C(F)(F)F)[C@H]([C@H](O)CCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H22F3NO3/c23-22(24,25)17-13-19(28)26(14-16-9-5-2-6-10-16)21(29)20(17)18(27)12-11-15-7-3-1-4-8-15/h1-10,17-18,20,27H,11-14H2/t17-,18-,20-/m1/s1 |
| InChIKey | VBUXWVKEXQXOAH-QWFCFKBJSA-N |
| XLogP | 3.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|