C19H15Cl3N2O3 — CID 139189107
(2S)-4,4,4-trichloro-N-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenylbutanamide (PubChem CID 139189107) has the molecular formula C19H15Cl3N2O3 and a molecular weight of 425.70 g/mol. Its IUPAC name is (2S)-4,4,4-trichloro-N-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenylbutanamide.
| Compound Name | (2S)-4,4,4-trichloro-N-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 139189107 |
| Molecular Formula | C19H15Cl3N2O3 |
| Molecular Weight | 425.70 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (2S)-4,4,4-trichloro-N-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenylbutanamide |
| SMILES | C[C@@H](CC(Cl)(Cl)Cl)C(=O)N(c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15Cl3N2O3/c1-12(11-19(20,21)22)16(25)23(13-7-3-2-4-8-13)24-17(26)14-9-5-6-10-15(14)18(24)27/h2-10,12H,11H2,1H3/t12-/m0/s1 |
| InChIKey | WXQIRIOEMRUKJJ-LBPRGKRZSA-N |
| XLogP | 4.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|