C44H46N10 — CID 139189116
5,5,10,15,15,20-hexamethyl-10,20-bis[(4-phenyltriazol-1-yl)methyl]-21,22,23,24-tetrahydroporphyrin (PubChem CID 139189116) has the molecular formula C44H46N10 and a molecular weight of 714.92 g/mol. Its IUPAC name is 5,5,10,15,15,20-hexamethyl-10,20-bis[(4-phenyltriazol-1-yl)methyl]-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,5,10,15,15,20-hexamethyl-10,20-bis[(4-phenyltriazol-1-yl)methyl]-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 139189116 |
| Molecular Formula | C44H46N10 |
| Molecular Weight | 714.92 g/mol |
| Exact Mass | 714.39 |
| IUPAC Name | 5,5,10,15,15,20-hexamethyl-10,20-bis[(4-phenyltriazol-1-yl)methyl]-21,22,23,24-tetrahydroporphyrin |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(Cn2cc(-c3ccccc3)nn2)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(Cn2cc(-c3ccccc3)nn2)c2ccc1[nH]2 |
| InChI | InChI=1S/C44H46N10/c1-41(2)33-17-21-37(45-33)43(5,27-53-25-31(49-51-53)29-13-9-7-10-14-29)39-23-19-35(47-39)42(3,4)36-20-24-40(48-36)44(6,38-22-18-34(41)46-38)28-54-26-32(50-52-54)30-15-11-8-12-16-30/h7-26,45-48H,27-28H2,1-6H3 |
| InChIKey | XVEOGIQCUGIDFN-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.92 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |