C27H18F3NO4S — CID 139189154
16-methoxy-19-phenyl-20-azoniapentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene;trifluoromethanesulfonate (PubChem CID 139189154) has the molecular formula C27H18F3NO4S and a molecular weight of 509.51 g/mol. Its IUPAC name is 16-methoxy-19-phenyl-20-azoniapentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene;trifluoromethanesulfonate.
| Compound Name | 16-methoxy-19-phenyl-20-azoniapentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139189154 |
| Molecular Formula | C27H18F3NO4S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 16-methoxy-19-phenyl-20-azoniapentacyclo[10.7.1.02,7.08,20.013,18]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene;trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)c(-c1ccccc1)c1[n+]3c(cccc23)-c2ccccc2-1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C26H18NO.CHF3O3S/c1-28-18-14-15-20-22(16-18)25(17-8-3-2-4-9-17)26-21-11-6-5-10-19(21)23-12-7-13-24(20)27(23)26;2-1(3,4)8(5,6)7/h2-16H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MHLBPDJPGBSUJW-UHFFFAOYSA-M |
| XLogP | 5.95 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|