About bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate
bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate (PubChem CID 139189158) has the molecular formula C70H67O6P
and a molecular weight of 1035.27 g/mol. Its IUPAC name is bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate.
Molecular Properties
| Compound Name | bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate |
| PubChem CID | 139189158 |
| Molecular Formula | C70H67O6P |
| Molecular Weight | 1035.27 g/mol |
| Exact Mass | 1034.47 |
| IUPAC Name | bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate |
| SMILES | CC(C)c1cc(C(c2ccccc2)c2ccccc2)c(OP(=O)(O)Oc2c(C(c3ccccc3)c3ccccc3)cc(C(C)C)cc2C(c2ccccc2)c2ccccc2)c(C(c2ccccc2)c2ccccc2)c1.O.O |
| InChI | InChI=1S/C70H63O4P.2H2O/c1-49(2)59-45-61(65(51-29-13-5-14-30-51)52-31-15-6-16-32-52)69(62(46-59)66(53-33-17-7-18-34-53)54-35-19-8-20-36-54)73-75(71,72)74-70-63(67(55-37-21-9-22-38-55)56-39-23-10-24-40-56)47-60(50(3)4)48-64(70)68(57-41-25-11-26-42-57)58-43-27-12-28-44-58;;/h5-50,65-68H,1-4H3,(H,71,72);2*1H2 |
| InChIKey | PZHSQKZYCZDZKF-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 77 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1035.27 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate?
The IUPAC name of bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate (CID 139189158) is bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate.
What is the SMILES notation for bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate?
The canonical SMILES for bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate is CC(C)c1cc(C(c2ccccc2)c2ccccc2)c(OP(=O)(O)Oc2c(C(c3ccccc3)c3ccccc3)cc(C(C)C)cc2C(c2ccccc2)c2ccccc2)c(C(c2ccccc2)c2ccccc2)c1.O.O.
What is the InChIKey of bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate?
The InChIKey is PZHSQKZYCZDZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C70H63O4P.2H2O/c1-49(2)59-45-61(65(51-29-13-5-14-30-51)52-31-15-6-16-32-52)69(62(46-59)66(53-33-17-7-18-34-53)54-35-19-8-20-36-54)73-75(71,72)74-70-63(67(55-37-21-9-22-38-55)56-39-23-10-24-40-56)47-60(50(3)4)48-64(70)68(57-41-25-11-26-42-57)58-43-27-12-28-44-58;;/h5-50,65-68H,1-4H3,(H,71,72);2*1H2.
What are the key properties of bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate?
bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate has a molecular weight of 1035.27 g/mol, XLogP of 16.56, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,6-dibenzhydryl-4-propan-2-ylphenyl) hydrogen phosphate;dihydrate is sourced from PubChem (CID 139189158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).