About CID 139189232
CID 139189232 (PubChem CID 139189232) has the molecular formula C99H114N18
and a molecular weight of 1556.13 g/mol.
Molecular Properties
| Compound Name | CID 139189232 |
| PubChem CID | 139189232 |
| Molecular Formula | C99H114N18 |
| Molecular Weight | 1556.13 g/mol |
| Exact Mass | 1554.95 |
| IUPAC Name | — |
| SMILES | Cc1nn2c(C)c1-c1ccc(cc1)CNCc1c(C)c3c(C)c(c1C)CNCc1ccc(cc1)-c1c(C)nn(c1C)Cn1nc(C)c(c1C)-c1ccc(cc1)CNCc1c(C)c(c(C)c(c1C)CNCc1ccc(cc1)-c1c(C)nn(c1C)Cn1nc(C)c(c1C)-c1ccc(cc1)CNC3)CNCc1ccc(cc1)-c1c(C)nn(c1C)C2 |
| InChI | InChI=1S/C99H114N18/c1-58-88-49-100-43-76-19-31-82(32-20-76)94-64(7)106-112(70(94)13)55-114-73(16)97(67(10)109-114)85-37-25-79(26-38-85)46-103-52-91-61(4)92-53-104-47-80-27-39-86(40-28-80)98-68(11)110-115(74(98)17)56-113-71(14)95(65(8)107-113)83-33-21-77(22-34-83)44-101-50-89(58)60(3)90(59(88)2)51-102-45-78-23-35-84(36-24-78)96-66(9)108-116(72(96)15)57-117-75(18)99(69(12)111-117)87-41-29-81(30-42-87)48-105-54-93(62(91)5)63(92)6/h19-42,100-105H,43-57H2,1-18H3 |
| InChIKey | BRVGQGUWVVKLRL-UHFFFAOYSA-N |
| XLogP | 18.30 |
| TPSA | 179.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | |
| Heavy Atoms | 117 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 1556.13 |
| LogP ≤ 5 | 18.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
Analyze CID 139189232 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139189232?
The IUPAC name of CID 139189232 (CID 139189232) is not available.
What is the SMILES notation for CID 139189232?
The canonical SMILES for CID 139189232 is Cc1nn2c(C)c1-c1ccc(cc1)CNCc1c(C)c3c(C)c(c1C)CNCc1ccc(cc1)-c1c(C)nn(c1C)Cn1nc(C)c(c1C)-c1ccc(cc1)CNCc1c(C)c(c(C)c(c1C)CNCc1ccc(cc1)-c1c(C)nn(c1C)Cn1nc(C)c(c1C)-c1ccc(cc1)CNC3)CNCc1ccc(cc1)-c1c(C)nn(c1C)C2.
What is the InChIKey of CID 139189232?
The InChIKey is BRVGQGUWVVKLRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C99H114N18/c1-58-88-49-100-43-76-19-31-82(32-20-76)94-64(7)106-112(70(94)13)55-114-73(16)97(67(10)109-114)85-37-25-79(26-38-85)46-103-52-91-61(4)92-53-104-47-80-27-39-86(40-28-80)98-68(11)110-115(74(98)17)56-113-71(14)95(65(8)107-113)83-33-21-77(22-34-83)44-101-50-89(58)60(3)90(59(88)2)51-102-45-78-23-35-84(36-24-78)96-66(9)108-116(72(96)15)57-117-75(18)99(69(12)111-117)87-41-29-81(30-42-87)48-105-54-93(62(91)5)63(92)6/h19-42,100-105H,43-57H2,1-18H3.
What are the key properties of CID 139189232?
CID 139189232 has a molecular weight of 1556.13 g/mol, XLogP of 18.30, 0 rotatable bonds, 6 hydrogen bond donors, and 18 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139189232 is sourced from PubChem (CID 139189232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).