C15H18O5 — CID 139189248
(2R,3S,3aS,6aR)-3-methoxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 139189248) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (2R,3S,3aS,6aR)-3-methoxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3S,3aS,6aR)-3-methoxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 139189248 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (2R,3S,3aS,6aR)-3-methoxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CO[C@@H]1[C@H]2OC(=O)C[C@H]2O[C@@H]1[C@H](OC)c1ccccc1 |
| InChI | InChI=1S/C15H18O5/c1-17-12(9-6-4-3-5-7-9)15-14(18-2)13-10(19-15)8-11(16)20-13/h3-7,10,12-15H,8H2,1-2H3/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | YTPMJYCPOBHNKO-TVKJYDDYSA-N |
| XLogP | 1.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |