C14H16O5 — CID 139189252
(2S,3S,3aR,6aR)-3-hydroxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 139189252) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2S,3S,3aR,6aR)-3-hydroxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2S,3S,3aR,6aR)-3-hydroxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 139189252 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2S,3S,3aR,6aR)-3-hydroxy-2-[(R)-methoxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CO[C@H](c1ccccc1)[C@H]1O[C@@H]2CC(=O)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C14H16O5/c1-17-12(8-5-3-2-4-6-8)14-11(16)13-9(18-14)7-10(15)19-13/h2-6,9,11-14,16H,7H2,1H3/t9-,11-,12-,13+,14+/m1/s1 |
| InChIKey | JGQRDRTZMBFDQJ-KVRLPLMBSA-N |
| XLogP | 0.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |