C19H21NO3S — CID 139189316
(1R,4R,7R,11S)-1-methyl-5-methylidene-2-(4-methylphenyl)sulfonyl-2-azatricyclo[5.3.1.04,11]undec-9-en-8-one (PubChem CID 139189316) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (1R,4R,7R,11S)-1-methyl-5-methylidene-2-(4-methylphenyl)sulfonyl-2-azatricyclo[5.3.1.04,11]undec-9-en-8-one.
| Compound Name | (1R,4R,7R,11S)-1-methyl-5-methylidene-2-(4-methylphenyl)sulfonyl-2-azatricyclo[5.3.1.04,11]undec-9-en-8-one |
|---|---|
| PubChem CID | 139189316 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (1R,4R,7R,11S)-1-methyl-5-methylidene-2-(4-methylphenyl)sulfonyl-2-azatricyclo[5.3.1.04,11]undec-9-en-8-one |
| SMILES | C=C1C[C@H]2C(=O)C=C[C@]3(C)[C@H]2[C@H]1CN3S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-12-4-6-14(7-5-12)24(22,23)20-11-16-13(2)10-15-17(21)8-9-19(20,3)18(15)16/h4-9,15-16,18H,2,10-11H2,1,3H3/t15-,16-,18+,19+/m0/s1 |
| InChIKey | SRDGBTLYIUXZSH-RNIPGJKVSA-N |
| XLogP | 2.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|