About 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole
2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 139189474) has the molecular formula C28H18N6S2
and a molecular weight of 502.63 g/mol. Its IUPAC name is 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole |
| PubChem CID | 139189474 |
| Molecular Formula | C28H18N6S2 |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | c1ccc(-c2cn3c(nc4ccccc43)s2)nc1.c1ccc(-c2cn3c(nc4ccccc43)s2)nc1 |
| InChI | InChI=1S/2C14H9N3S/c2*1-2-7-12-10(5-1)16-14-17(12)9-13(18-14)11-6-3-4-8-15-11/h2*1-9H |
| InChIKey | FUFIZHDBQZEVNK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole?
The IUPAC name of 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole (CID 139189474) is 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole.
What is the SMILES notation for 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole?
The canonical SMILES for 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole is c1ccc(-c2cn3c(nc4ccccc43)s2)nc1.c1ccc(-c2cn3c(nc4ccccc43)s2)nc1.
What is the InChIKey of 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole?
The InChIKey is FUFIZHDBQZEVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H9N3S/c2*1-2-7-12-10(5-1)16-14-17(12)9-13(18-14)11-6-3-4-8-15-11/h2*1-9H.
What are the key properties of 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole?
2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole has a molecular weight of 502.63 g/mol, XLogP of 7.22, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-[1,3]thiazolo[3,2-a]benzimidazole is sourced from PubChem (CID 139189474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).