About 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine
3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine (PubChem CID 139189560) has the molecular formula C22H18BrNO4S2
and a molecular weight of 504.43 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine |
| PubChem CID | 139189560 |
| Molecular Formula | C22H18BrNO4S2 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine |
| SMILES | Cc1ccc(S(=O)(=O)C2(S(=O)(=O)c3ccc(C)cc3)N=C2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H18BrNO4S2/c1-15-3-11-19(12-4-15)29(25,26)22(21(24-22)17-7-9-18(23)10-8-17)30(27,28)20-13-5-16(2)6-14-20/h3-14H,1-2H3 |
| InChIKey | SBFOTSAAQBAYJT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine?
The IUPAC name of 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine (CID 139189560) is 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine.
What is the SMILES notation for 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine?
The canonical SMILES for 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine is Cc1ccc(S(=O)(=O)C2(S(=O)(=O)c3ccc(C)cc3)N=C2c2ccc(Br)cc2)cc1.
What is the InChIKey of 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine?
The InChIKey is SBFOTSAAQBAYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18BrNO4S2/c1-15-3-11-19(12-4-15)29(25,26)22(21(24-22)17-7-9-18(23)10-8-17)30(27,28)20-13-5-16(2)6-14-20/h3-14H,1-2H3.
What are the key properties of 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine?
3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine has a molecular weight of 504.43 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-2,2-bis-(4-methylphenyl)sulfonylazirine is sourced from PubChem (CID 139189560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).