C28H40FNO3S — CID 139189763
N-benzyl-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[(4R,5S)-5-fluoroundec-1-yn-4-yl]methanesulfonamide (PubChem CID 139189763) has the molecular formula C28H40FNO3S and a molecular weight of 489.70 g/mol. Its IUPAC name is N-benzyl-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[(4R,5S)-5-fluoroundec-1-yn-4-yl]methanesulfonamide.
| Compound Name | N-benzyl-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[(4R,5S)-5-fluoroundec-1-yn-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 139189763 |
| Molecular Formula | C28H40FNO3S |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-benzyl-1-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-[(4R,5S)-5-fluoroundec-1-yn-4-yl]methanesulfonamide |
| SMILES | C#CC[C@H]([C@@H](F)CCCCCC)N(Cc1ccccc1)S(=O)(=O)C[C@]12CC[C@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C28H40FNO3S/c1-5-7-8-12-16-24(29)25(13-6-2)30(20-22-14-10-9-11-15-22)34(32,33)21-28-18-17-23(19-26(28)31)27(28,3)4/h2,9-11,14-15,23-25H,5,7-8,12-13,16-21H2,1,3-4H3/t23-,24+,25-,28-/m1/s1 |
| InChIKey | ULGWBJDVUHSUPU-KALPRAJFSA-N |
| XLogP | 5.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|