C16H22O10 — CID 139189958
methyl (1R,2S,3R,4R,5S)-2,3,4,5-tetraacetyloxycyclohexane-1-carboxylate (PubChem CID 139189958) has the molecular formula C16H22O10 and a molecular weight of 374.34 g/mol. Its IUPAC name is methyl (1R,2S,3R,4R,5S)-2,3,4,5-tetraacetyloxycyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4R,5S)-2,3,4,5-tetraacetyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139189958 |
| Molecular Formula | C16H22O10 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | methyl (1R,2S,3R,4R,5S)-2,3,4,5-tetraacetyloxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O10/c1-7(17)23-12-6-11(16(21)22-5)13(24-8(2)18)15(26-10(4)20)14(12)25-9(3)19/h11-15H,6H2,1-5H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | CDOLPZJBLZIAPY-GZBLMMOJSA-N |
| XLogP | -0.09 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|