C20H24OS — CID 139190010
5-[(S)-tert-butylsulfinyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (PubChem CID 139190010) has the molecular formula C20H24OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 5-[(S)-tert-butylsulfinyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene.
| Compound Name | 5-[(S)-tert-butylsulfinyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
|---|---|
| PubChem CID | 139190010 |
| Molecular Formula | C20H24OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-[(S)-tert-butylsulfinyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| SMILES | CC(C)(C)[S@](=O)c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C20H24OS/c1-20(2,3)22(21)19-14-17-9-8-15-4-6-16(7-5-15)10-12-18(19)13-11-17/h4-7,11,13-14H,8-10,12H2,1-3H3/t22-/m1/s1 |
| InChIKey | DNJQNIZEEKONBY-JOCHJYFZSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |