C54H60O4S2 — CID 139190011
(R)-[6-[(R)-tert-butylsulfinyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-phenylmethanol (PubChem CID 139190011) has the molecular formula C54H60O4S2 and a molecular weight of 837.20 g/mol. Its IUPAC name is (R)-[6-[(R)-tert-butylsulfinyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-phenylmethanol.
| Compound Name | (R)-[6-[(R)-tert-butylsulfinyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-phenylmethanol |
|---|---|
| PubChem CID | 139190011 |
| Molecular Formula | C54H60O4S2 |
| Molecular Weight | 837.20 g/mol |
| Exact Mass | 836.39 |
| IUPAC Name | (R)-[6-[(R)-tert-butylsulfinyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl]-phenylmethanol |
| SMILES | CC(C)(C)[S@@](=O)c1c2ccc(c1[C@H](O)c1ccccc1)CCc1ccc(cc1)CC2.CC(C)(C)[S@@](=O)c1c2ccc(c1[C@H](O)c1ccccc1)CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/2C27H30O2S/c2*1-27(2,3)30(29)26-23-16-14-20-11-9-19(10-12-20)13-15-21(17-18-23)24(26)25(28)22-7-5-4-6-8-22/h2*4-12,17-18,25,28H,13-16H2,1-3H3/t2*25-,30+/m11/s1 |
| InChIKey | KIOLNEKBSOIYIB-XNNACZSUSA-N |
| XLogP | 11.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.20 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |