C18H25NO2 — CID 139190168
[(1'S,2R,3aS,7S)-2-phenylspiro[2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridine-7,2'-cyclopentane]-1'-yl]methanol (PubChem CID 139190168) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(1'S,2R,3aS,7S)-2-phenylspiro[2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridine-7,2'-cyclopentane]-1'-yl]methanol.
| Compound Name | [(1'S,2R,3aS,7S)-2-phenylspiro[2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridine-7,2'-cyclopentane]-1'-yl]methanol |
|---|---|
| PubChem CID | 139190168 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(1'S,2R,3aS,7S)-2-phenylspiro[2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-a]pyridine-7,2'-cyclopentane]-1'-yl]methanol |
| SMILES | OC[C@H]1CCC[C@]12CCC[C@H]1C[C@H](c3ccccc3)ON12 |
| InChI | InChI=1S/C18H25NO2/c20-13-15-8-4-10-18(15)11-5-9-16-12-17(21-19(16)18)14-6-2-1-3-7-14/h1-3,6-7,15-17,20H,4-5,8-13H2/t15-,16+,17-,18+/m1/s1 |
| InChIKey | OBMXWGNEBPDDSA-XDNAFOTISA-N |
| XLogP | 3.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |