C24H28N8 — CID 139190196
1-ethyl-3-[(1Z,3E)-4-pyrrol-1-ylbuta-1,3-dienyl]-1,2,4-triazole (PubChem CID 139190196) has the molecular formula C24H28N8 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-ethyl-3-[(1Z,3E)-4-pyrrol-1-ylbuta-1,3-dienyl]-1,2,4-triazole.
| Compound Name | 1-ethyl-3-[(1Z,3E)-4-pyrrol-1-ylbuta-1,3-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 139190196 |
| Molecular Formula | C24H28N8 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-ethyl-3-[(1Z,3E)-4-pyrrol-1-ylbuta-1,3-dienyl]-1,2,4-triazole |
| SMILES | CCn1cnc(/C=C\C=C\n2cccc2)n1.CCn1cnc(/C=C\C=C\n2cccc2)n1 |
| InChI | InChI=1S/2C12H14N4/c2*1-2-16-11-13-12(14-16)7-3-4-8-15-9-5-6-10-15/h2*3-11H,2H2,1H3/b2*7-3-,8-4+ |
| InChIKey | KVHJWVBPQBYEGV-FYBBJYFVSA-N |
| XLogP | 4.57 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|